Difference between revisions of "Omega-7 fatty acids"
From Wikiwel
| Line 19: | Line 19: | ||
| 7-Tetradecenoic acid | | 7-Tetradecenoic acid | ||
|- | |- | ||
| − | | | + | | Palmitoleic acid |
| 16:1 (''n''−7) | | 16:1 (''n''−7) | ||
| 9-Hexadecenoic acid | | 9-Hexadecenoic acid | ||
|- | |- | ||
| − | | | + | | Vaccenic acid |
| 18:1 (''n''−7) | | 18:1 (''n''−7) | ||
| 11-Octadecenoic acid | | 11-Octadecenoic acid | ||
|- | |- | ||
| − | | | + | | Paullinic acid |
| 20:1 (''n''−7) | | 20:1 (''n''−7) | ||
| 13-Eicosenoic acid | | 13-Eicosenoic acid | ||
Revision as of 02:08, 23 June 2013
See also :
Omega-7 fatty acids are a class of unsaturated fatty acids in which the site of unsaturation is seven carbon atoms from the end of the carbon chain. The two most common omega-7 fatty acids in nature are palmitoleic acid and vaccenic acid . Rich sources include macadamia nut oil and Sea Buckthorn oil. The monounsaturated omega-7 fatty acids have the general chemical structure CH3-(CH2)5-CH=CH-(CH2)n-CO2H.
| Common name | Lipid name | Chemical name |
|---|---|---|
| none | 12:1 (n−7) | 5-Dodecenoic acid |
| none | 14:1 (n−7) | 7-Tetradecenoic acid |
| Palmitoleic acid | 16:1 (n−7) | 9-Hexadecenoic acid |
| Vaccenic acid | 18:1 (n−7) | 11-Octadecenoic acid |
| Paullinic acid | 20:1 (n−7) | 13-Eicosenoic acid |
| none | 22:1 (n−7) | 15-Docosenoic acid |
| none | 24:1 (n−7) | 17-Tetracosenoic acid |
